C35H54N4O — CID 142511108
(3Z)-2,3-dimethylhepta-1,3-diene;2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-[(3S)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511108) has the molecular formula C35H54N4O and a molecular weight of 546.84 g/mol. Its IUPAC name is (3Z)-2,3-dimethylhepta-1,3-diene;2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-[(3S)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (3Z)-2,3-dimethylhepta-1,3-diene;2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-[(3S)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511108 |
| Molecular Formula | C35H54N4O |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | (3Z)-2,3-dimethylhepta-1,3-diene;2-[(2E,7Z)-8,9-dimethylundeca-2,7-dien-2-yl]-7-[(3S)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(C)/C(C)=C\CCC.CCC(C)/C(C)=C\CCC/C=C(\C)c1cc(=O)n2cc(N3CCN[C@@H](C)C3)ccc2n1 |
| InChI | InChI=1S/C26H38N4O.C9H16/c1-6-19(2)20(3)10-8-7-9-11-21(4)24-16-26(31)30-18-23(12-13-25(30)28-24)29-15-14-27-22(5)17-29;1-5-6-7-9(4)8(2)3/h10-13,16,18-19,22,27H,6-9,14-15,17H2,1-5H3;7H,2,5-6H2,1,3-4H3/b20-10-,21-11+;9-7-/t19?,22-;/m0./s1 |
| InChIKey | QEHZPEAOSPJKAG-IWFGNAHKSA-N |
| XLogP | 8.37 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|