C38H57N5O — CID 142511237
(E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511237) has the molecular formula C38H57N5O and a molecular weight of 599.91 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511237 |
| Molecular Formula | C38H57N5O |
| Molecular Weight | 599.91 g/mol |
| Exact Mass | 599.46 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C4COC4)CC3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C28H37N5O.C10H20/c1-5-20(2)21(3)15-25(29-4)26-16-27(22-7-6-8-22)33-17-23(9-10-28(33)30-26)31-11-13-32(14-12-31)24-18-34-19-24;1-5-7-8-10(4)9(3)6-2/h9-10,15-17,24H,2,5-8,11-14,18-19H2,1,3-4H3;8-9H,5-7H2,1-4H3/b21-15+,29-25+;10-8- |
| InChIKey | QQYIDSZYYHDKHW-WMLQDIBRSA-N |
| XLogP | 8.21 |
| TPSA | 43.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.91 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|