C28H37N5O — CID 142511238
(E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 142511238) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine.
| Compound Name | (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
|---|---|
| PubChem CID | 142511238 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-[4-(oxetan-3-yl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C4COC4)CC3)C=CC2=N1 |
| InChI | InChI=1S/C28H37N5O/c1-5-20(2)21(3)15-25(29-4)26-16-27(22-7-6-8-22)33-17-23(9-10-28(33)30-26)31-11-13-32(14-12-31)24-18-34-19-24/h9-10,15-17,24H,2,5-8,11-14,18-19H2,1,3-4H3/b21-15+,29-25+ |
| InChIKey | XRERWTLIWSFTHN-XPTAHJBUSA-N |
| XLogP | 4.43 |
| TPSA | 43.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|