C26H35N5 — CID 142511028
(E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 142511028) has the molecular formula C26H35N5 and a molecular weight of 417.60 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine.
| Compound Name | (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
|---|---|
| PubChem CID | 142511028 |
| Molecular Formula | C26H35N5 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C)CC3)C=CC2=N1 |
| InChI | InChI=1S/C26H35N5/c1-6-19(2)20(3)16-23(27-4)24-17-25(21-8-7-9-21)31-18-22(10-11-26(31)28-24)30-14-12-29(5)13-15-30/h10-11,16-18H,2,6-9,12-15H2,1,3-5H3/b20-16+,27-23+ |
| InChIKey | WEJRDEVTNHBPDP-BYFYCWJZSA-N |
| XLogP | 4.66 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|