C34H50N4O — CID 142511171
2-[4-[2-[(2E,4E,5Z)-6,7-dimethyl-4-(2-methyl-1-prop-1-en-2-ylbutylidene)nona-2,5-dien-2-yl]-4-methylidenepyrido[1,2-a]pyrimidin-7-yl]piperazin-1-yl]ethanol (PubChem CID 142511171) has the molecular formula C34H50N4O and a molecular weight of 530.80 g/mol. Its IUPAC name is 2-[4-[2-[(2E,4E,5Z)-6,7-dimethyl-4-(2-methyl-1-prop-1-en-2-ylbutylidene)nona-2,5-dien-2-yl]-4-methylidenepyrido[1,2-a]pyrimidin-7-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-[(2E,4E,5Z)-6,7-dimethyl-4-(2-methyl-1-prop-1-en-2-ylbutylidene)nona-2,5-dien-2-yl]-4-methylidenepyrido[1,2-a]pyrimidin-7-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 142511171 |
| Molecular Formula | C34H50N4O |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | 2-[4-[2-[(2E,4E,5Z)-6,7-dimethyl-4-(2-methyl-1-prop-1-en-2-ylbutylidene)nona-2,5-dien-2-yl]-4-methylidenepyrido[1,2-a]pyrimidin-7-yl]piperazin-1-yl]ethanol |
| SMILES | C=C(C)/C(=C(/C=C(/C)C(C)CC)\C=C(/C)C1=CC(=C)N2C=C(N3CCN(CCO)CC3)C=CC2=N1)C(C)CC |
| InChI | InChI=1S/C34H50N4O/c1-10-25(5)27(7)20-30(34(24(3)4)26(6)11-2)21-28(8)32-22-29(9)38-23-31(12-13-33(38)35-32)37-16-14-36(15-17-37)18-19-39/h12-13,20-23,25-26,39H,3,9-11,14-19H2,1-2,4-8H3/b27-20-,28-21+,34-30- |
| InChIKey | OSZVRUFIUIVBJY-CMKFDZEOSA-N |
| XLogP | 6.98 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|