C32H49N5O2 — CID 142511322
2-[C-[(1E)-2,3-dimethylbuta-1,3-dienyl]-N-methylcarbonimidoyl]-7-[4-(2-hydroxyethyl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511322) has the molecular formula C32H49N5O2 and a molecular weight of 535.78 g/mol. Its IUPAC name is 2-[C-[(1E)-2,3-dimethylbuta-1,3-dienyl]-N-methylcarbonimidoyl]-7-[4-(2-hydroxyethyl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | 2-[C-[(1E)-2,3-dimethylbuta-1,3-dienyl]-N-methylcarbonimidoyl]-7-[4-(2-hydroxyethyl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511322 |
| Molecular Formula | C32H49N5O2 |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.39 |
| IUPAC Name | 2-[C-[(1E)-2,3-dimethylbuta-1,3-dienyl]-N-methylcarbonimidoyl]-7-[4-(2-hydroxyethyl)piperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=N\C)c1cc(=O)n2cc(N3CCN(CCO)CC3)ccc2n1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C22H29N5O2.C10H20/c1-16(2)17(3)13-19(23-4)20-14-22(29)27-15-18(5-6-21(27)24-20)26-9-7-25(8-10-26)11-12-28;1-5-7-8-10(4)9(3)6-2/h5-6,13-15,28H,1,7-12H2,2-4H3;8-9H,5-7H2,1-4H3/b17-13+,23-19+;10-8- |
| InChIKey | YOBASUCVHNHJAA-WDDXPZLRSA-N |
| XLogP | 5.53 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|