C34H53N5O2 — CID 142511290
(Z)-3,4-dimethyloct-4-ene;7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-[N-methyl-C-[(E)-2-methyl-3-methylidenehex-1-enyl]carbonimidoyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511290) has the molecular formula C34H53N5O2 and a molecular weight of 563.83 g/mol. Its IUPAC name is (Z)-3,4-dimethyloct-4-ene;7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-[N-methyl-C-[(E)-2-methyl-3-methylidenehex-1-enyl]carbonimidoyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (Z)-3,4-dimethyloct-4-ene;7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-[N-methyl-C-[(E)-2-methyl-3-methylidenehex-1-enyl]carbonimidoyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511290 |
| Molecular Formula | C34H53N5O2 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.42 |
| IUPAC Name | (Z)-3,4-dimethyloct-4-ene;7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-[N-methyl-C-[(E)-2-methyl-3-methylidenehex-1-enyl]carbonimidoyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(CCC)/C(C)=C/C(=N\C)c1cc(=O)n2cc(N3CCN(CCO)CC3)ccc2n1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C24H33N5O2.C10H20/c1-5-6-18(2)19(3)15-21(25-4)22-16-24(31)29-17-20(7-8-23(29)26-22)28-11-9-27(10-12-28)13-14-30;1-5-7-8-10(4)9(3)6-2/h7-8,15-17,30H,2,5-6,9-14H2,1,3-4H3;8-9H,5-7H2,1-4H3/b19-15+,25-21+;10-8- |
| InChIKey | SBRQKVDFMLXXFF-RQQNDOBWSA-N |
| XLogP | 6.31 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|