C6H11ClN2S2 — CID 142513971
1-(4,5-dihydro-1,3-thiazol-2-yl)azetidine-2-thiol;hydrochloride (PubChem CID 142513971) has the molecular formula C6H11ClN2S2 and a molecular weight of 210.75 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)azetidine-2-thiol;hydrochloride.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)azetidine-2-thiol;hydrochloride |
|---|---|
| PubChem CID | 142513971 |
| Molecular Formula | C6H11ClN2S2 |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)azetidine-2-thiol;hydrochloride |
| SMILES | Cl.SC1CCN1C1=NCCS1 |
| InChI | InChI=1S/C6H10N2S2.ClH/c9-5-1-3-8(5)6-7-2-4-10-6;/h5,9H,1-4H2;1H |
| InChIKey | CHZRITUCGPPBFB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|