C7H14N2S2 — CID 142894457
1-[4,5-dihydro-1,3-thiazol-2-yl(methyl)amino]propane-2-thiol (PubChem CID 142894457) has the molecular formula C7H14N2S2 and a molecular weight of 190.34 g/mol. Its IUPAC name is 1-[4,5-dihydro-1,3-thiazol-2-yl(methyl)amino]propane-2-thiol.
| Compound Name | 1-[4,5-dihydro-1,3-thiazol-2-yl(methyl)amino]propane-2-thiol |
|---|---|
| PubChem CID | 142894457 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-[4,5-dihydro-1,3-thiazol-2-yl(methyl)amino]propane-2-thiol |
| SMILES | CC(S)CN(C)C1=NCCS1 |
| InChI | InChI=1S/C7H14N2S2/c1-6(10)5-9(2)7-8-3-4-11-7/h6,10H,3-5H2,1-2H3 |
| InChIKey | OQDHLRNOQYXSLM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|