C9H10N4 — CID 142514446
5-ethenyl-1,7-dimethylpyrazolo[4,3-d]pyrimidine (PubChem CID 142514446) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 5-ethenyl-1,7-dimethylpyrazolo[4,3-d]pyrimidine.
| Compound Name | 5-ethenyl-1,7-dimethylpyrazolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 142514446 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-ethenyl-1,7-dimethylpyrazolo[4,3-d]pyrimidine |
| SMILES | C=Cc1nc(C)c2c(cnn2C)n1 |
| InChI | InChI=1S/C9H10N4/c1-4-8-11-6(2)9-7(12-8)5-10-13(9)3/h4-5H,1H2,2-3H3 |
| InChIKey | AHAUFIABYXJMCU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |