C12H14N2 — CID 167037820
7-ethenyl-1,5,6-trimethylindazole (PubChem CID 167037820) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 7-ethenyl-1,5,6-trimethylindazole.
| Compound Name | 7-ethenyl-1,5,6-trimethylindazole |
|---|---|
| PubChem CID | 167037820 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 7-ethenyl-1,5,6-trimethylindazole |
| SMILES | C=Cc1c(C)c(C)cc2cnn(C)c12 |
| InChI | InChI=1S/C12H14N2/c1-5-11-9(3)8(2)6-10-7-13-14(4)12(10)11/h5-7H,1H2,2-4H3 |
| InChIKey | ZKSHANPAURZXDO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |