C10H16N4 — CID 163275069
ethane;1,5,7-trimethylpyrazolo[4,3-d]pyrimidine (PubChem CID 163275069) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is ethane;1,5,7-trimethylpyrazolo[4,3-d]pyrimidine.
| Compound Name | ethane;1,5,7-trimethylpyrazolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 163275069 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | ethane;1,5,7-trimethylpyrazolo[4,3-d]pyrimidine |
| SMILES | CC.Cc1nc(C)c2c(cnn2C)n1 |
| InChI | InChI=1S/C8H10N4.C2H6/c1-5-8-7(4-9-12(8)3)11-6(2)10-5;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | JOIZGUBXGICVIH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |