C8H8N2OS — CID 142514452
N-methyl-4H-thieno[3,2-b]pyrrole-6-carboxamide (PubChem CID 142514452) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is N-methyl-4H-thieno[3,2-b]pyrrole-6-carboxamide.
| Compound Name | N-methyl-4H-thieno[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 142514452 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | N-methyl-4H-thieno[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(=O)c1c[nH]c2ccsc12 |
| InChI | InChI=1S/C8H8N2OS/c1-9-8(11)5-4-10-6-2-3-12-7(5)6/h2-4,10H,1H3,(H,9,11) |
| InChIKey | KJQFAYZSDSBTRI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |