C12H11N7O3 — CID 1425165
6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)pyrimidine-2,4-dione (PubChem CID 1425165) has the molecular formula C12H11N7O3 and a molecular weight of 301.27 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1425165 |
| Molecular Formula | C12H11N7O3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/C=N/c2ncnc3nc[nH]c23)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H11N7O3/c1-18-10(20)6(11(21)19(2)12(18)22)3-13-8-7-9(15-4-14-7)17-5-16-8/h3-5,20H,1-2H3,(H,14,15,16,17)/b13-3+ |
| InChIKey | YQVBSSPMJQPDBY-QLKAYGNNSA-N |
| XLogP | -0.79 |
| TPSA | 131.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|