C12H11N7O2S — CID 137123939
6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 137123939) has the molecular formula C12H11N7O2S and a molecular weight of 317.33 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 137123939 |
| Molecular Formula | C12H11N7O2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-(7H-purin-6-yliminomethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cn1c(O)c(/C=N/c2ncnc3nc[nH]c23)c(=O)n(C)c1=S |
| InChI | InChI=1S/C12H11N7O2S/c1-18-10(20)6(11(21)19(2)12(18)22)3-13-8-7-9(15-4-14-7)17-5-16-8/h3-5,20H,1-2H3,(H,14,15,16,17)/b13-3+ |
| InChIKey | IQODGJIFJDGJBE-QLKAYGNNSA-N |
| XLogP | 0.58 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|