C14H16N4O5S — CID 137035533
4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-N-methylbenzenesulfonamide (PubChem CID 137035533) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 137035533 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(/N=C/c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C14H16N4O5S/c1-15-24(22,23)10-6-4-9(5-7-10)16-8-11-12(19)17(2)14(21)18(3)13(11)20/h4-8,15,19H,1-3H3/b16-8+ |
| InChIKey | CZBPPEXUTMPYJK-LZYBPNLTSA-N |
| XLogP | -0.55 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|