C19H23ClN4O — CID 142517077
4-chloro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine;ethane (PubChem CID 142517077) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 4-chloro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine;ethane.
| Compound Name | 4-chloro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine;ethane |
|---|---|
| PubChem CID | 142517077 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-chloro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine;ethane |
| SMILES | CC.Nc1cc(Cl)c2ccc(-c3ccnn3C3CCCCO3)cc2n1 |
| InChI | InChI=1S/C17H17ClN4O.C2H6/c18-13-10-16(19)21-14-9-11(4-5-12(13)14)15-6-7-20-22(15)17-3-1-2-8-23-17;1-2/h4-7,9-10,17H,1-3,8H2,(H2,19,21);1-2H3 |
| InChIKey | LIUAQDDKQQUFMM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |