C26H34N2O — CID 142519887
1,8-diazaspiro[4.5]decan-8-yl-[(3S,5R,8R)-5-methyl-3-phenyl-1-tetracyclo[5.2.1.03,8.05,8]decanyl]methanone (PubChem CID 142519887) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is 1,8-diazaspiro[4.5]decan-8-yl-[(3S,5R,8R)-5-methyl-3-phenyl-1-tetracyclo[5.2.1.03,8.05,8]decanyl]methanone.
| Compound Name | 1,8-diazaspiro[4.5]decan-8-yl-[(3S,5R,8R)-5-methyl-3-phenyl-1-tetracyclo[5.2.1.03,8.05,8]decanyl]methanone |
|---|---|
| PubChem CID | 142519887 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 1,8-diazaspiro[4.5]decan-8-yl-[(3S,5R,8R)-5-methyl-3-phenyl-1-tetracyclo[5.2.1.03,8.05,8]decanyl]methanone |
| SMILES | C[C@@]12CC3CC4(C(=O)N5CCC6(CCCN6)CC5)C[C@](c5ccccc5)(C1)[C@]32C4 |
| InChI | InChI=1S/C26H34N2O/c1-22-14-20-15-23(21(29)28-12-9-24(10-13-28)8-5-11-27-24)17-25(16-22,26(20,22)18-23)19-6-3-2-4-7-19/h2-4,6-7,20,27H,5,8-18H2,1H3/t20?,22-,23?,25+,26-/m1/s1 |
| InChIKey | FBEMJZVADPDUIT-SUBLJDFBSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |