C25H31N5O2S — CID 142521409
5-[4-[(dimethylamino)methyl]phenyl]-N-[(2-ethoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-3-amine (PubChem CID 142521409) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 5-[4-[(dimethylamino)methyl]phenyl]-N-[(2-ethoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-3-amine.
| Compound Name | 5-[4-[(dimethylamino)methyl]phenyl]-N-[(2-ethoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-3-amine |
|---|---|
| PubChem CID | 142521409 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 5-[4-[(dimethylamino)methyl]phenyl]-N-[(2-ethoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-3-amine |
| SMILES | CCOc1ncc(N2CCOCC2)cc1SNc1cncc(-c2ccc(CN(C)C)cc2)c1 |
| InChI | InChI=1S/C25H31N5O2S/c1-4-32-25-24(14-23(17-27-25)30-9-11-31-12-10-30)33-28-22-13-21(15-26-16-22)20-7-5-19(6-8-20)18-29(2)3/h5-8,13-17,28H,4,9-12,18H2,1-3H3 |
| InChIKey | OTKHQLZVFKCNIG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|