C19H20N6O2 — CID 142523191
2-[ethyl-(3-formylpyrazolo[1,5-a]pyrimidin-5-yl)amino]-3-[2-(methylamino)ethoxy]benzonitrile (PubChem CID 142523191) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[ethyl-(3-formylpyrazolo[1,5-a]pyrimidin-5-yl)amino]-3-[2-(methylamino)ethoxy]benzonitrile.
| Compound Name | 2-[ethyl-(3-formylpyrazolo[1,5-a]pyrimidin-5-yl)amino]-3-[2-(methylamino)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 142523191 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[ethyl-(3-formylpyrazolo[1,5-a]pyrimidin-5-yl)amino]-3-[2-(methylamino)ethoxy]benzonitrile |
| SMILES | CCN(c1ccn2ncc(C=O)c2n1)c1c(C#N)cccc1OCCNC |
| InChI | InChI=1S/C19H20N6O2/c1-3-24(17-7-9-25-19(23-17)15(13-26)12-22-25)18-14(11-20)5-4-6-16(18)27-10-8-21-2/h4-7,9,12-13,21H,3,8,10H2,1-2H3 |
| InChIKey | XGYIQZRAXDSAGO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|