C10H17F2N — CID 142523581
(4R)-4-[(E)-but-2-en-2-yl]-3,3-difluoro-1-methylpiperidine (PubChem CID 142523581) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is (4R)-4-[(E)-but-2-en-2-yl]-3,3-difluoro-1-methylpiperidine.
| Compound Name | (4R)-4-[(E)-but-2-en-2-yl]-3,3-difluoro-1-methylpiperidine |
|---|---|
| PubChem CID | 142523581 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (4R)-4-[(E)-but-2-en-2-yl]-3,3-difluoro-1-methylpiperidine |
| SMILES | C/C=C(\C)[C@H]1CCN(C)CC1(F)F |
| InChI | InChI=1S/C10H17F2N/c1-4-8(2)9-5-6-13(3)7-10(9,11)12/h4,9H,5-7H2,1-3H3/b8-4+/t9-/m1/s1 |
| InChIKey | SFQZUSHVRCROGV-VGANXODHSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|