C18H37N5O5 — CID 142525910
2-amino-N-methylacetamide;tert-butyl N-[N'-butyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 142525910) has the molecular formula C18H37N5O5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-amino-N-methylacetamide;tert-butyl N-[N'-butyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | 2-amino-N-methylacetamide;tert-butyl N-[N'-butyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 142525910 |
| Molecular Formula | C18H37N5O5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 2-amino-N-methylacetamide;tert-butyl N-[N'-butyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.CNC(=O)CN |
| InChI | InChI=1S/C15H29N3O4.C3H8N2O/c1-8-9-10-16-11(17-12(19)21-14(2,3)4)18-13(20)22-15(5,6)7;1-5-3(6)2-4/h8-10H2,1-7H3,(H2,16,17,18,19,20);2,4H2,1H3,(H,5,6) |
| InChIKey | DXGXRECIPJZUDL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|