C26H39N3O5 — CID 142527020
ethyl 2-methyl-2-[7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptoxy]propanoate (PubChem CID 142527020) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is ethyl 2-methyl-2-[7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptoxy]propanoate |
|---|---|
| PubChem CID | 142527020 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | ethyl 2-methyl-2-[7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)OCCCCCCCOc1ccc(-c2ccnn2C2CCCCO2)nc1 |
| InChI | InChI=1S/C26H39N3O5/c1-4-31-25(30)26(2,3)34-19-10-7-5-6-9-17-32-21-13-14-22(27-20-21)23-15-16-28-29(23)24-12-8-11-18-33-24/h13-16,20,24H,4-12,17-19H2,1-3H3 |
| InChIKey | NPFLXJDSGMPEGY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|