C43H58N8O9 — CID 146658429
bis[3-carbamoyl-7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptan-2-yl] carbonate (PubChem CID 146658429) has the molecular formula C43H58N8O9 and a molecular weight of 830.98 g/mol. Its IUPAC name is bis[3-carbamoyl-7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptan-2-yl] carbonate.
| Compound Name | bis[3-carbamoyl-7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptan-2-yl] carbonate |
|---|---|
| PubChem CID | 146658429 |
| Molecular Formula | C43H58N8O9 |
| Molecular Weight | 830.98 g/mol |
| Exact Mass | 830.43 |
| IUPAC Name | bis[3-carbamoyl-7-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxy]heptan-2-yl] carbonate |
| SMILES | CC(OC(=O)OC(C)C(CCCCOc1ccc(-c2ccnn2C2CCCCO2)nc1)C(N)=O)C(CCCCOc1ccc(-c2ccnn2C2CCCCO2)nc1)C(N)=O |
| InChI | InChI=1S/C43H58N8O9/c1-29(33(41(44)52)11-3-7-23-55-31-15-17-35(46-27-31)37-19-21-48-50(37)39-13-5-9-25-57-39)59-43(54)60-30(2)34(42(45)53)12-4-8-24-56-32-16-18-36(47-28-32)38-20-22-49-51(38)40-14-6-10-26-58-40/h15-22,27-30,33-34,39-40H,3-14,23-26H2,1-2H3,(H2,44,52)(H2,45,53) |
| InChIKey | LRUKBMMVNPSQNQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 220.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.98 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|