C19H23ClFN5O2 — CID 142528070
N-[(5Z)-5-amino-6-[amino-(3-cyanocyclobutyl)amino]hexa-1,5-dien-2-yl]-2-(4-chloro-3-fluorophenoxy)acetamide (PubChem CID 142528070) has the molecular formula C19H23ClFN5O2 and a molecular weight of 407.88 g/mol. Its IUPAC name is N-[(5Z)-5-amino-6-[amino-(3-cyanocyclobutyl)amino]hexa-1,5-dien-2-yl]-2-(4-chloro-3-fluorophenoxy)acetamide.
| Compound Name | N-[(5Z)-5-amino-6-[amino-(3-cyanocyclobutyl)amino]hexa-1,5-dien-2-yl]-2-(4-chloro-3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 142528070 |
| Molecular Formula | C19H23ClFN5O2 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[(5Z)-5-amino-6-[amino-(3-cyanocyclobutyl)amino]hexa-1,5-dien-2-yl]-2-(4-chloro-3-fluorophenoxy)acetamide |
| SMILES | C=C(CC/C(N)=C/N(N)C1CC(C#N)C1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H23ClFN5O2/c1-12(2-3-14(23)10-26(24)15-6-13(7-15)9-22)25-19(27)11-28-16-4-5-17(20)18(21)8-16/h4-5,8,10,13,15H,1-3,6-7,11,23-24H2,(H,25,27)/b14-10- |
| InChIKey | QIWMJSGYWSVGMT-UVTDQMKNSA-N |
| XLogP | 2.55 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|