C10H12N4O2S — CID 142530573
10-(hydroxymethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one;methane (PubChem CID 142530573) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 10-(hydroxymethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one;methane.
| Compound Name | 10-(hydroxymethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one;methane |
|---|---|
| PubChem CID | 142530573 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 10-(hydroxymethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one;methane |
| SMILES | C.Cn1c2ncsc2c2cnn(CO)c(=O)c21 |
| InChI | InChI=1S/C9H8N4O2S.CH4/c1-12-6-5(7-8(12)10-3-16-7)2-11-13(4-14)9(6)15;/h2-3,14H,4H2,1H3;1H4 |
| InChIKey | VWUGHICUUUWJIC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |