C18H20N4O2S — CID 142530869
10-[(3E,5Z)-4-methoxy-2-methylidenehepta-3,5-dienyl]-4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 142530869) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 10-[(3E,5Z)-4-methoxy-2-methylidenehepta-3,5-dienyl]-4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[(3E,5Z)-4-methoxy-2-methylidenehepta-3,5-dienyl]-4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 142530869 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 10-[(3E,5Z)-4-methoxy-2-methylidenehepta-3,5-dienyl]-4,7-dimethyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | C=C(/C=C(\C=C/C)OC)Cn1ncc2c3sc(C)nc3n(C)c2c1=O |
| InChI | InChI=1S/C18H20N4O2S/c1-6-7-13(24-5)8-11(2)10-22-18(23)15-14(9-19-22)16-17(21(15)4)20-12(3)25-16/h6-9H,2,10H2,1,3-5H3/b7-6-,13-8+ |
| InChIKey | ZPAVYNPEWTURSC-ONVRAGQBSA-N |
| XLogP | 3.32 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|