C19H23ClF2N3OSi+ — CID 142533713
2-[[4-chloro-2-[5-(1,1-difluoroethyl)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium (PubChem CID 142533713) has the molecular formula C19H23ClF2N3OSi+ and a molecular weight of 410.95 g/mol. Its IUPAC name is 2-[[4-chloro-2-[5-(1,1-difluoroethyl)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium.
| Compound Name | 2-[[4-chloro-2-[5-(1,1-difluoroethyl)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
|---|---|
| PubChem CID | 142533713 |
| Molecular Formula | C19H23ClF2N3OSi+ |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[[4-chloro-2-[5-(1,1-difluoroethyl)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
| SMILES | C[SiH2+](C)CCOCn1c(-c2cncc(C(C)(F)F)c2)cc2c(Cl)ccnc21 |
| InChI | InChI=1S/C19H23ClF2N3OSi/c1-19(21,22)14-8-13(10-23-11-14)17-9-15-16(20)4-5-24-18(15)25(17)12-26-6-7-27(2)3/h4-5,8-11H,6-7,12,27H2,1-3H3/q+1 |
| InChIKey | HWDGKXNRADLMRD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|