C28H30Cl2N2O3 — CID 142535260
acetaldehyde;(E)-1-(4-chlorophenyl)-N-methoxyethanimine;(E)-1-(4-chlorophenyl)-N-[1-(2-methylphenyl)ethenoxy]ethanimine (PubChem CID 142535260) has the molecular formula C28H30Cl2N2O3 and a molecular weight of 513.47 g/mol. Its IUPAC name is acetaldehyde;(E)-1-(4-chlorophenyl)-N-methoxyethanimine;(E)-1-(4-chlorophenyl)-N-[1-(2-methylphenyl)ethenoxy]ethanimine.
| Compound Name | acetaldehyde;(E)-1-(4-chlorophenyl)-N-methoxyethanimine;(E)-1-(4-chlorophenyl)-N-[1-(2-methylphenyl)ethenoxy]ethanimine |
|---|---|
| PubChem CID | 142535260 |
| Molecular Formula | C28H30Cl2N2O3 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | acetaldehyde;(E)-1-(4-chlorophenyl)-N-methoxyethanimine;(E)-1-(4-chlorophenyl)-N-[1-(2-methylphenyl)ethenoxy]ethanimine |
| SMILES | C=C(O/N=C(\C)c1ccc(Cl)cc1)c1ccccc1C.CC=O.CO/N=C(\C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO.C9H10ClNO.C2H4O/c1-12-6-4-5-7-17(12)14(3)20-19-13(2)15-8-10-16(18)11-9-15;1-7(11-12-2)8-3-5-9(10)6-4-8;1-2-3/h4-11H,3H2,1-2H3;3-6H,1-2H3;2H,1H3/b19-13+;11-7+; |
| InChIKey | XGNFYCSZHCVNIW-LSNLPIIMSA-N |
| XLogP | 7.98 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|