C12H15N3O — CID 18713749
(2Z)-N'-ethenyl-2-methoxyimino-2-(2-methylphenyl)ethanimidamide (PubChem CID 18713749) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (2Z)-N'-ethenyl-2-methoxyimino-2-(2-methylphenyl)ethanimidamide.
| Compound Name | (2Z)-N'-ethenyl-2-methoxyimino-2-(2-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 18713749 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2Z)-N'-ethenyl-2-methoxyimino-2-(2-methylphenyl)ethanimidamide |
| SMILES | C=C/N=C(N)/C(=N\OC)c1ccccc1C |
| InChI | InChI=1S/C12H15N3O/c1-4-14-12(13)11(15-16-3)10-8-6-5-7-9(10)2/h4-8H,1H2,2-3H3,(H2,13,14)/b15-11- |
| InChIKey | SSUOMEHSPXCNIS-PTNGSMBKSA-N |
| XLogP | 1.85 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|