C16H20N4O3S — CID 59939733
N-[(3E)-3-[[2-[(E)-C-carbamothioyl-N-methoxycarbonimidoyl]-6-methylphenyl]methoxyimino]butan-2-ylidene]formamide (PubChem CID 59939733) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[(3E)-3-[[2-[(E)-C-carbamothioyl-N-methoxycarbonimidoyl]-6-methylphenyl]methoxyimino]butan-2-ylidene]formamide.
| Compound Name | N-[(3E)-3-[[2-[(E)-C-carbamothioyl-N-methoxycarbonimidoyl]-6-methylphenyl]methoxyimino]butan-2-ylidene]formamide |
|---|---|
| PubChem CID | 59939733 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[(3E)-3-[[2-[(E)-C-carbamothioyl-N-methoxycarbonimidoyl]-6-methylphenyl]methoxyimino]butan-2-ylidene]formamide |
| SMILES | CO/N=C(/C(N)=S)c1cccc(C)c1CO/N=C(C)/C(C)=N/C=O |
| InChI | InChI=1S/C16H20N4O3S/c1-10-6-5-7-13(15(16(17)24)20-22-4)14(10)8-23-19-12(3)11(2)18-9-21/h5-7,9H,8H2,1-4H3,(H2,17,24)/b18-11+,19-12+,20-15+ |
| InChIKey | NMNCBQGMBRIPKN-AMWFLLJVSA-N |
| XLogP | 2.14 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|