C20H25N3O2S — CID 142535607
ethane;N-[2-[2-(hydroxymethyl)phenyl]ethyl]-7-methyl-2H-1,2,4-benzothiadiazine-3-carboxamide (PubChem CID 142535607) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is ethane;N-[2-[2-(hydroxymethyl)phenyl]ethyl]-7-methyl-2H-1,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | ethane;N-[2-[2-(hydroxymethyl)phenyl]ethyl]-7-methyl-2H-1,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 142535607 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethane;N-[2-[2-(hydroxymethyl)phenyl]ethyl]-7-methyl-2H-1,2,4-benzothiadiazine-3-carboxamide |
| SMILES | CC.Cc1ccc2c(c1)SNC(C(=O)NCCc1ccccc1CO)=N2 |
| InChI | InChI=1S/C18H19N3O2S.C2H6/c1-12-6-7-15-16(10-12)24-21-17(20-15)18(23)19-9-8-13-4-2-3-5-14(13)11-22;1-2/h2-7,10,22H,8-9,11H2,1H3,(H,19,23)(H,20,21);1-2H3 |
| InChIKey | XTWPXCYECKRRDY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|