C18H15N5O3S — CID 142535768
N-[2-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]ethyl]-2H-1,2,4-benzothiadiazine-3-carboxamide (PubChem CID 142535768) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-[2-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]ethyl]-2H-1,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | N-[2-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]ethyl]-2H-1,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 142535768 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]ethyl]-2H-1,2,4-benzothiadiazine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1-c1n[nH]c(=O)o1)C1=Nc2ccccc2SN1 |
| InChI | InChI=1S/C18H15N5O3S/c24-16(15-20-13-7-3-4-8-14(13)27-23-15)19-10-9-11-5-1-2-6-12(11)17-21-22-18(25)26-17/h1-8H,9-10H2,(H,19,24)(H,20,23)(H,22,25) |
| InChIKey | DFPHJKHQMTXPFJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|