C27H35ClFN3O3 — CID 142536912
tert-butyl (2R)-2-[[3-chloro-4-[(4-fluorophenyl)methyl-propylamino]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 142536912) has the molecular formula C27H35ClFN3O3 and a molecular weight of 504.05 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-chloro-4-[(4-fluorophenyl)methyl-propylamino]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-chloro-4-[(4-fluorophenyl)methyl-propylamino]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142536912 |
| Molecular Formula | C27H35ClFN3O3 |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | tert-butyl (2R)-2-[[3-chloro-4-[(4-fluorophenyl)methyl-propylamino]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCN(Cc1ccc(F)cc1)c1ccc(NC(=O)[C@H]2CCCCN2C(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C27H35ClFN3O3/c1-5-15-31(18-19-9-11-20(29)12-10-19)23-14-13-21(17-22(23)28)30-25(33)24-8-6-7-16-32(24)26(34)35-27(2,3)4/h9-14,17,24H,5-8,15-16,18H2,1-4H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | YLRMMVMRQSLVSW-XMMPIXPASA-N |
| XLogP | 6.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|