C37H57ClN2O4S — CID 142537644
22-(4-chloro-2-propylphenyl)-7-[(1R)-1-hydroxyethyl]-6,11,12-trimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatricyclo[14.7.2.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane (PubChem CID 142537644) has the molecular formula C37H57ClN2O4S and a molecular weight of 661.39 g/mol. Its IUPAC name is 22-(4-chloro-2-propylphenyl)-7-[(1R)-1-hydroxyethyl]-6,11,12-trimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatricyclo[14.7.2.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane.
| Compound Name | 22-(4-chloro-2-propylphenyl)-7-[(1R)-1-hydroxyethyl]-6,11,12-trimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatricyclo[14.7.2.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane |
|---|---|
| PubChem CID | 142537644 |
| Molecular Formula | C37H57ClN2O4S |
| Molecular Weight | 661.39 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 22-(4-chloro-2-propylphenyl)-7-[(1R)-1-hydroxyethyl]-6,11,12-trimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatricyclo[14.7.2.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane |
| SMILES | CC.CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(CCCCC(C)C([C@@H](C)O)CCCC(C)C(C)S(=O)NC3=O)C1 |
| InChI | InChI=1S/C35H51ClN2O4S.C2H6/c1-6-10-27-19-30(36)15-16-32(27)29-21-38-18-8-7-11-24(3)31(25(4)39)13-9-12-23(2)26(5)43(41)37-35(40)28-14-17-34(42-22-29)33(38)20-28;1-2/h14-17,19-20,23-26,29,31,39H,6-13,18,21-22H2,1-5H3,(H,37,40);1-2H3/t23?,24?,25-,26?,29?,31?,43?;/m1./s1 |
| InChIKey | MJTOSYLOHNYFAX-CMZMSDKRSA-N |
| XLogP | 8.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.39 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |