C17H20N4O2S — CID 142539714
S-[2-[4-(5,6-dimethoxybenzimidazol-1-yl)phenyl]ethylamino]thiohydroxylamine (PubChem CID 142539714) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is S-[2-[4-(5,6-dimethoxybenzimidazol-1-yl)phenyl]ethylamino]thiohydroxylamine.
| Compound Name | S-[2-[4-(5,6-dimethoxybenzimidazol-1-yl)phenyl]ethylamino]thiohydroxylamine |
|---|---|
| PubChem CID | 142539714 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | S-[2-[4-(5,6-dimethoxybenzimidazol-1-yl)phenyl]ethylamino]thiohydroxylamine |
| SMILES | COc1cc2ncn(-c3ccc(CCNSN)cc3)c2cc1OC |
| InChI | InChI=1S/C17H20N4O2S/c1-22-16-9-14-15(10-17(16)23-2)21(11-19-14)13-5-3-12(4-6-13)7-8-20-24-18/h3-6,9-11,20H,7-8,18H2,1-2H3 |
| InChIKey | BEQAHQYGDJNWCH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|