C50H38F3N3O6 — CID 142540609
4-[[3,5-bis[(4-fluorophenyl)methoxy]phenoxy]-[3,5-bis(pyridin-4-ylmethoxy)phenoxy]-(4-fluorophenyl)methyl]pyridine (PubChem CID 142540609) has the molecular formula C50H38F3N3O6 and a molecular weight of 833.86 g/mol. Its IUPAC name is 4-[[3,5-bis[(4-fluorophenyl)methoxy]phenoxy]-[3,5-bis(pyridin-4-ylmethoxy)phenoxy]-(4-fluorophenyl)methyl]pyridine.
| Compound Name | 4-[[3,5-bis[(4-fluorophenyl)methoxy]phenoxy]-[3,5-bis(pyridin-4-ylmethoxy)phenoxy]-(4-fluorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 142540609 |
| Molecular Formula | C50H38F3N3O6 |
| Molecular Weight | 833.86 g/mol |
| Exact Mass | 833.27 |
| IUPAC Name | 4-[[3,5-bis[(4-fluorophenyl)methoxy]phenoxy]-[3,5-bis(pyridin-4-ylmethoxy)phenoxy]-(4-fluorophenyl)methyl]pyridine |
| SMILES | Fc1ccc(COc2cc(OCc3ccc(F)cc3)cc(OC(Oc3cc(OCc4ccncc4)cc(OCc4ccncc4)c3)(c3ccncc3)c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C50H38F3N3O6/c51-41-7-1-35(2-8-41)31-57-44-25-45(58-32-36-3-9-42(52)10-4-36)28-48(27-44)61-50(40-17-23-56-24-18-40,39-5-11-43(53)12-6-39)62-49-29-46(59-33-37-13-19-54-20-14-37)26-47(30-49)60-34-38-15-21-55-22-16-38/h1-30H,31-34H2 |
| InChIKey | JECMRKUGZAEFAR-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.86 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|