About N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide
N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide (PubChem CID 142542161) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide |
| PubChem CID | 142542161 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide |
| SMILES | CCNC(=O)N1CC2(CNC2)C1 |
| InChI | InChI=1S/C8H15N3O/c1-2-10-7(12)11-5-8(6-11)3-9-4-8/h9H,2-6H2,1H3,(H,10,12) |
| InChIKey | BHEHCGOVMZUMFV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide?
The IUPAC name of N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide (CID 142542161) is N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide.
What is the SMILES notation for N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide?
The canonical SMILES for N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide is CCNC(=O)N1CC2(CNC2)C1.
What is the InChIKey of N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide?
The InChIKey is BHEHCGOVMZUMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-2-10-7(12)11-5-8(6-11)3-9-4-8/h9H,2-6H2,1H3,(H,10,12).
What are the key properties of N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide?
N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide has a molecular weight of 169.23 g/mol, XLogP of -0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,6-diazaspiro[3.3]heptane-2-carboxamide is sourced from PubChem (CID 142542161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).