C6H10N2OS — CID 170787306
2,6-diazaspiro[3.3]heptane-2-carbothioic S-acid (PubChem CID 170787306) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 2,6-diazaspiro[3.3]heptane-2-carbothioic S-acid.
| Compound Name | 2,6-diazaspiro[3.3]heptane-2-carbothioic S-acid |
|---|---|
| PubChem CID | 170787306 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2,6-diazaspiro[3.3]heptane-2-carbothioic S-acid |
| SMILES | O=C(S)N1CC2(CNC2)C1 |
| InChI | InChI=1S/C6H10N2OS/c9-5(10)8-3-6(4-8)1-7-2-6/h7H,1-4H2,(H,9,10) |
| InChIKey | GMRBDYOPZIZMPV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|