C18H22Cl2N2S — CID 142542257
3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-piperidin-2-ylprop-1-enyl]but-3-en-2-imine (PubChem CID 142542257) has the molecular formula C18H22Cl2N2S and a molecular weight of 369.36 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-piperidin-2-ylprop-1-enyl]but-3-en-2-imine.
| Compound Name | 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-piperidin-2-ylprop-1-enyl]but-3-en-2-imine |
|---|---|
| PubChem CID | 142542257 |
| Molecular Formula | C18H22Cl2N2S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-piperidin-2-ylprop-1-enyl]but-3-en-2-imine |
| SMILES | C=C(Sc1cccc(Cl)c1Cl)/C(C)=N/C(=C\C)C1CCCCN1 |
| InChI | InChI=1S/C18H22Cl2N2S/c1-4-15(16-9-5-6-11-21-16)22-12(2)13(3)23-17-10-7-8-14(19)18(17)20/h4,7-8,10,16,21H,3,5-6,9,11H2,1-2H3/b15-4-,22-12+ |
| InChIKey | FYDASCBHMMVURB-ZXEHQQNQSA-N |
| XLogP | 6.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|