C19H26Cl2N2S — CID 142542266
3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-pyrrolidin-2-ylprop-1-enyl]but-3-en-2-imine;ethane (PubChem CID 142542266) has the molecular formula C19H26Cl2N2S and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-pyrrolidin-2-ylprop-1-enyl]but-3-en-2-imine;ethane.
| Compound Name | 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-pyrrolidin-2-ylprop-1-enyl]but-3-en-2-imine;ethane |
|---|---|
| PubChem CID | 142542266 |
| Molecular Formula | C19H26Cl2N2S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(2,3-dichlorophenyl)sulfanyl-N-[(Z)-1-pyrrolidin-2-ylprop-1-enyl]but-3-en-2-imine;ethane |
| SMILES | C=C(Sc1cccc(Cl)c1Cl)/C(C)=N/C(=C\C)C1CCCN1.CC |
| InChI | InChI=1S/C17H20Cl2N2S.C2H6/c1-4-14(15-8-6-10-20-15)21-11(2)12(3)22-16-9-5-7-13(18)17(16)19;1-2/h4-5,7,9,15,20H,3,6,8,10H2,1-2H3;1-2H3/b14-4-,21-11+; |
| InChIKey | ZIAHQSRKXYSHJL-GSPJDZNDSA-N |
| XLogP | 6.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|