C10H11Cl2N3S — CID 155703004
N'-[(E)-2-amino-2-(2,3-dichlorophenyl)sulfanylethenyl]ethanimidamide (PubChem CID 155703004) has the molecular formula C10H11Cl2N3S and a molecular weight of 276.19 g/mol. Its IUPAC name is N'-[(E)-2-amino-2-(2,3-dichlorophenyl)sulfanylethenyl]ethanimidamide.
| Compound Name | N'-[(E)-2-amino-2-(2,3-dichlorophenyl)sulfanylethenyl]ethanimidamide |
|---|---|
| PubChem CID | 155703004 |
| Molecular Formula | C10H11Cl2N3S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | N'-[(E)-2-amino-2-(2,3-dichlorophenyl)sulfanylethenyl]ethanimidamide |
| SMILES | C/C(N)=N\C=C(/N)Sc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2N3S/c1-6(13)15-5-9(14)16-8-4-2-3-7(11)10(8)12/h2-5H,14H2,1H3,(H2,13,15)/b9-5+ |
| InChIKey | OGLLTNMFQPFVOY-WEVVVXLNSA-N |
| XLogP | 3.22 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|