C8H8Cl2N2OS — CID 57086054
2-(2,3-dichlorophenyl)sulfanyl-N'-hydroxyethanimidamide (PubChem CID 57086054) has the molecular formula C8H8Cl2N2OS and a molecular weight of 251.14 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)sulfanyl-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,3-dichlorophenyl)sulfanyl-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 57086054 |
| Molecular Formula | C8H8Cl2N2OS |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 2-(2,3-dichlorophenyl)sulfanyl-N'-hydroxyethanimidamide |
| SMILES | NC(CSc1cccc(Cl)c1Cl)=NO |
| InChI | InChI=1S/C8H8Cl2N2OS/c9-5-2-1-3-6(8(5)10)14-4-7(11)12-13/h1-3,13H,4H2,(H2,11,12) |
| InChIKey | FOTCQYIOIIOKGP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|