C24H18Cl2O2 — CID 142542402
(2E)-2-[(3,5-dichlorophenyl)methylidene]-5-[(4-methylphenyl)methoxy]-3H-inden-1-one (PubChem CID 142542402) has the molecular formula C24H18Cl2O2 and a molecular weight of 409.31 g/mol. Its IUPAC name is (2E)-2-[(3,5-dichlorophenyl)methylidene]-5-[(4-methylphenyl)methoxy]-3H-inden-1-one.
| Compound Name | (2E)-2-[(3,5-dichlorophenyl)methylidene]-5-[(4-methylphenyl)methoxy]-3H-inden-1-one |
|---|---|
| PubChem CID | 142542402 |
| Molecular Formula | C24H18Cl2O2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (2E)-2-[(3,5-dichlorophenyl)methylidene]-5-[(4-methylphenyl)methoxy]-3H-inden-1-one |
| SMILES | Cc1ccc(COc2ccc3c(c2)C/C(=C\c2cc(Cl)cc(Cl)c2)C3=O)cc1 |
| InChI | InChI=1S/C24H18Cl2O2/c1-15-2-4-16(5-3-15)14-28-22-6-7-23-18(12-22)11-19(24(23)27)8-17-9-20(25)13-21(26)10-17/h2-10,12-13H,11,14H2,1H3/b19-8+ |
| InChIKey | WKBZCOMNODHVDM-UFWORHAWSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|