C23H16Br2O2 — CID 126377452
(2E)-2-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 126377452) has the molecular formula C23H16Br2O2 and a molecular weight of 484.19 g/mol. Its IUPAC name is (2E)-2-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3H-inden-1-one.
| Compound Name | (2E)-2-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 126377452 |
| Molecular Formula | C23H16Br2O2 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | (2E)-2-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(OCc3ccccc3)c(Br)c2)Cc2ccccc21 |
| InChI | InChI=1S/C23H16Br2O2/c24-20-11-16(10-18-13-17-8-4-5-9-19(17)22(18)26)12-21(25)23(20)27-14-15-6-2-1-3-7-15/h1-12H,13-14H2/b18-10+ |
| InChIKey | NZPRHKBKOIMFQT-VCHYOVAHSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|