C11H19F — CID 142543146
4-[(2S)-but-3-en-2-yl]-1-fluoro-1-methylcyclohexane (PubChem CID 142543146) has the molecular formula C11H19F and a molecular weight of 170.27 g/mol. Its IUPAC name is 4-[(2S)-but-3-en-2-yl]-1-fluoro-1-methylcyclohexane.
| Compound Name | 4-[(2S)-but-3-en-2-yl]-1-fluoro-1-methylcyclohexane |
|---|---|
| PubChem CID | 142543146 |
| Molecular Formula | C11H19F |
| Molecular Weight | 170.27 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 4-[(2S)-but-3-en-2-yl]-1-fluoro-1-methylcyclohexane |
| SMILES | C=C[C@H](C)C1CCC(C)(F)CC1 |
| InChI | InChI=1S/C11H19F/c1-4-9(2)10-5-7-11(3,12)8-6-10/h4,9-10H,1,5-8H2,2-3H3/t9-,10?,11?/m0/s1 |
| InChIKey | YEQSIPFGLPHBQZ-WHXUTIOJSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|