C13H23F — CID 158566716
4-[(E)-3,3-dimethylbut-1-enyl]-1-fluoro-1-methylcyclohexane (PubChem CID 158566716) has the molecular formula C13H23F and a molecular weight of 198.32 g/mol. Its IUPAC name is 4-[(E)-3,3-dimethylbut-1-enyl]-1-fluoro-1-methylcyclohexane.
| Compound Name | 4-[(E)-3,3-dimethylbut-1-enyl]-1-fluoro-1-methylcyclohexane |
|---|---|
| PubChem CID | 158566716 |
| Molecular Formula | C13H23F |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 4-[(E)-3,3-dimethylbut-1-enyl]-1-fluoro-1-methylcyclohexane |
| SMILES | CC(C)(C)/C=C/C1CCC(C)(F)CC1 |
| InChI | InChI=1S/C13H23F/c1-12(2,3)8-5-11-6-9-13(4,14)10-7-11/h5,8,11H,6-7,9-10H2,1-4H3/b8-5+ |
| InChIKey | WAYWHXVFMUZRAL-VMPITWQZSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|