C14H24F2 — CID 158566719
1-(1,1-difluoroethyl)-4-[(E)-3,3-dimethylbut-1-enyl]cyclohexane (PubChem CID 158566719) has the molecular formula C14H24F2 and a molecular weight of 230.34 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-4-[(E)-3,3-dimethylbut-1-enyl]cyclohexane.
| Compound Name | 1-(1,1-difluoroethyl)-4-[(E)-3,3-dimethylbut-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 158566719 |
| Molecular Formula | C14H24F2 |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(1,1-difluoroethyl)-4-[(E)-3,3-dimethylbut-1-enyl]cyclohexane |
| SMILES | CC(C)(C)/C=C/C1CCC(C(C)(F)F)CC1 |
| InChI | InChI=1S/C14H24F2/c1-13(2,3)10-9-11-5-7-12(8-6-11)14(4,15)16/h9-12H,5-8H2,1-4H3/b10-9+ |
| InChIKey | GBTWUHUIADTXMV-MDZDMXLPSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|