C12H20O — CID 130596270
(E)-4-(4,4-dimethylcyclohexyl)but-3-en-2-one (PubChem CID 130596270) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-4-(4,4-dimethylcyclohexyl)but-3-en-2-one.
| Compound Name | (E)-4-(4,4-dimethylcyclohexyl)but-3-en-2-one |
|---|---|
| PubChem CID | 130596270 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (E)-4-(4,4-dimethylcyclohexyl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C12H20O/c1-10(13)4-5-11-6-8-12(2,3)9-7-11/h4-5,11H,6-9H2,1-3H3/b5-4+ |
| InChIKey | VAYXDKYMZNXIQY-SNAWJCMRSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|