C13H19ClO — CID 57031902
4-(5-chloro-2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-one (PubChem CID 57031902) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 4-(5-chloro-2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-one.
| Compound Name | 4-(5-chloro-2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-one |
|---|---|
| PubChem CID | 57031902 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-(5-chloro-2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-one |
| SMILES | C=C1C(Cl)CCC(C)(C)C1C=CC(C)=O |
| InChI | InChI=1S/C13H19ClO/c1-9(15)5-6-11-10(2)12(14)7-8-13(11,3)4/h5-6,11-12H,2,7-8H2,1,3-4H3 |
| InChIKey | KPFGZUUJCYOTQQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|